C22H24ClN5O3S — CID 22332488
6-(3-chloro-4-methoxyphenyl)-N-(3-methoxypropyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 22332488) has the molecular formula C22H24ClN5O3S and a molecular weight of 473.99 g/mol. Its IUPAC name is 6-(3-chloro-4-methoxyphenyl)-N-(3-methoxypropyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | 6-(3-chloro-4-methoxyphenyl)-N-(3-methoxypropyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 22332488 |
| Molecular Formula | C22H24ClN5O3S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 6-(3-chloro-4-methoxyphenyl)-N-(3-methoxypropyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | COCCCNC(=O)C1Sc2nnc(-c3ccccc3)n2NC1c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C22H24ClN5O3S/c1-30-12-6-11-24-21(29)19-18(15-9-10-17(31-2)16(23)13-15)27-28-20(25-26-22(28)32-19)14-7-4-3-5-8-14/h3-5,7-10,13,18-19,27H,6,11-12H2,1-2H3,(H,24,29) |
| InChIKey | ANGZMYWUQVCEON-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|