C23H25N5O3S — CID 22332482
[6-(4-ethoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-morpholin-4-ylmethanone (PubChem CID 22332482) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is [6-(4-ethoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(4-ethoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 22332482 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [6-(4-ethoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-morpholin-4-ylmethanone |
| SMILES | CCOc1ccc(C2Nn3c(nnc3-c3ccccc3)SC2C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H25N5O3S/c1-2-31-18-10-8-16(9-11-18)19-20(22(29)27-12-14-30-15-13-27)32-23-25-24-21(28(23)26-19)17-6-4-3-5-7-17/h3-11,19-20,26H,2,12-15H2,1H3 |
| InChIKey | ZHURVGZNHRBSTE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |