C17H21N5O2S — CID 92651414
[(6S,7S)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-pyrrolidin-1-ylmethanone (PubChem CID 92651414) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is [(6S,7S)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(6S,7S)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 92651414 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [(6S,7S)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1ccc([C@@H]2Nn3c(C)nnc3S[C@@H]2C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H21N5O2S/c1-11-18-19-17-22(11)20-14(12-5-7-13(24-2)8-6-12)15(25-17)16(23)21-9-3-4-10-21/h5-8,14-15,20H,3-4,9-10H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | ZCIOLVLZFRRJKY-GJZGRUSLSA-N |
| XLogP | 1.98 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |