C18H22ClN5OS — CID 2428466
[(6S,7R)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 2428466) has the molecular formula C18H22ClN5OS and a molecular weight of 391.93 g/mol. Its IUPAC name is [(6S,7R)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [(6S,7R)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 2428466 |
| Molecular Formula | C18H22ClN5OS |
| Molecular Weight | 391.93 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [(6S,7R)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | Cc1nnc2n1N[C@@H](c1ccc(Cl)cc1)[C@H](C(=O)N1CCC(C)CC1)S2 |
| InChI | InChI=1S/C18H22ClN5OS/c1-11-7-9-23(10-8-11)17(25)16-15(13-3-5-14(19)6-4-13)22-24-12(2)20-21-18(24)26-16/h3-6,11,15-16,22H,7-10H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | FLQDTJICYBLZSK-JKSUJKDBSA-N |
| XLogP | 3.26 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |