C18H14ClFN4OS — CID 2389121
[(6S,7S)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-fluorophenyl)methanone (PubChem CID 2389121) has the molecular formula C18H14ClFN4OS and a molecular weight of 388.86 g/mol. Its IUPAC name is [(6S,7S)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(6S,7S)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 2389121 |
| Molecular Formula | C18H14ClFN4OS |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [(6S,7S)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-fluorophenyl)methanone |
| SMILES | Cc1nnc2n1N[C@@H](c1ccc(Cl)cc1)[C@@H](C(=O)c1ccc(F)cc1)S2 |
| InChI | InChI=1S/C18H14ClFN4OS/c1-10-21-22-18-24(10)23-15(11-2-6-13(19)7-3-11)17(26-18)16(25)12-4-8-14(20)9-5-12/h2-9,15,17,23H,1H3/t15-,17-/m0/s1 |
| InChIKey | WCEXSUOTMRJLQO-RDJZCZTQSA-N |
| XLogP | 4.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |