C18H23N5OS — CID 92651496
[(6S,7R)-3-methyl-6-(4-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-piperidin-1-ylmethanone (PubChem CID 92651496) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is [(6S,7R)-3-methyl-6-(4-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-piperidin-1-ylmethanone.
| Compound Name | [(6S,7R)-3-methyl-6-(4-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 92651496 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [(6S,7R)-3-methyl-6-(4-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1ccc([C@@H]2Nn3c(C)nnc3S[C@H]2C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H23N5OS/c1-12-6-8-14(9-7-12)15-16(17(24)22-10-4-3-5-11-22)25-18-20-19-13(2)23(18)21-15/h6-9,15-16,21H,3-5,10-11H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | ZQFQJRJRASGVDY-JKSUJKDBSA-N |
| XLogP | 2.67 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |