C30H30N4O3S — CID 2386992
methyl 4-[(6S,7R)-3-(4-tert-butylphenyl)-7-(4-methylbenzoyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate (PubChem CID 2386992) has the molecular formula C30H30N4O3S and a molecular weight of 526.66 g/mol. Its IUPAC name is methyl 4-[(6S,7R)-3-(4-tert-butylphenyl)-7-(4-methylbenzoyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate.
| Compound Name | methyl 4-[(6S,7R)-3-(4-tert-butylphenyl)-7-(4-methylbenzoyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate |
|---|---|
| PubChem CID | 2386992 |
| Molecular Formula | C30H30N4O3S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | methyl 4-[(6S,7R)-3-(4-tert-butylphenyl)-7-(4-methylbenzoyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nn3c(nnc3-c3ccc(C(C)(C)C)cc3)S[C@H]2C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H30N4O3S/c1-18-6-8-20(9-7-18)25(35)26-24(19-10-12-22(13-11-19)28(36)37-5)33-34-27(31-32-29(34)38-26)21-14-16-23(17-15-21)30(2,3)4/h6-17,24,26,33H,1-5H3/t24-,26+/m0/s1 |
| InChIKey | FUYFDAVKOPHXDM-AZGAKELHSA-N |
| XLogP | 5.98 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |