C27H25N5O3S — CID 40978847
methyl 4-[(6R,7R)-7-[(2,6-dimethylphenyl)carbamoyl]-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate (PubChem CID 40978847) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is methyl 4-[(6R,7R)-7-[(2,6-dimethylphenyl)carbamoyl]-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate.
| Compound Name | methyl 4-[(6R,7R)-7-[(2,6-dimethylphenyl)carbamoyl]-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate |
|---|---|
| PubChem CID | 40978847 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | methyl 4-[(6R,7R)-7-[(2,6-dimethylphenyl)carbamoyl]-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C27H25N5O3S/c1-16-8-7-9-17(2)21(16)28-25(33)23-22(18-12-14-20(15-13-18)26(34)35-3)31-32-24(29-30-27(32)36-23)19-10-5-4-6-11-19/h4-15,22-23,31H,1-3H3,(H,28,33)/t22-,23-/m1/s1 |
| InChIKey | VFDZUQVSWMFFDG-DHIUTWEWSA-N |
| XLogP | 4.75 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |