C26H23N5O3S — CID 22332469
methyl 4-[7-(benzylcarbamoyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate (PubChem CID 22332469) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is methyl 4-[7-(benzylcarbamoyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate.
| Compound Name | methyl 4-[7-(benzylcarbamoyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate |
|---|---|
| PubChem CID | 22332469 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | methyl 4-[7-(benzylcarbamoyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2Nn3c(nnc3-c3ccccc3)SC2C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5O3S/c1-34-25(33)20-14-12-18(13-15-20)21-22(24(32)27-16-17-8-4-2-5-9-17)35-26-29-28-23(31(26)30-21)19-10-6-3-7-11-19/h2-15,21-22,30H,16H2,1H3,(H,27,32) |
| InChIKey | QWEYBKVVXFXBFG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |