C13H12F3N5O2S — CID 35137283
(6S,7S)-6-(4-methoxyphenyl)-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 35137283) has the molecular formula C13H12F3N5O2S and a molecular weight of 359.33 g/mol. Its IUPAC name is (6S,7S)-6-(4-methoxyphenyl)-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | (6S,7S)-6-(4-methoxyphenyl)-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 35137283 |
| Molecular Formula | C13H12F3N5O2S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (6S,7S)-6-(4-methoxyphenyl)-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | COc1ccc([C@@H]2Nn3c(nnc3C(F)(F)F)S[C@@H]2C(N)=O)cc1 |
| InChI | InChI=1S/C13H12F3N5O2S/c1-23-7-4-2-6(3-5-7)8-9(10(17)22)24-12-19-18-11(13(14,15)16)21(12)20-8/h2-5,8-9,20H,1H3,(H2,17,22)/t8-,9-/m0/s1 |
| InChIKey | UVINPQDAYONPDV-IUCAKERBSA-N |
| XLogP | 1.55 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |