C18H17N5O2S — CID 46910906
ethyl (6R,7R)-6-phenyl-3-pyridin-4-yl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylate (PubChem CID 46910906) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is ethyl (6R,7R)-6-phenyl-3-pyridin-4-yl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylate.
| Compound Name | ethyl (6R,7R)-6-phenyl-3-pyridin-4-yl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 46910906 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | ethyl (6R,7R)-6-phenyl-3-pyridin-4-yl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Sc2nnc(-c3ccncc3)n2N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17N5O2S/c1-2-25-17(24)15-14(12-6-4-3-5-7-12)22-23-16(20-21-18(23)26-15)13-8-10-19-11-9-13/h3-11,14-15,22H,2H2,1H3/t14-,15-/m1/s1 |
| InChIKey | ODMFEKCOVJGPDC-HUUCEWRRSA-N |
| XLogP | 2.66 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |