C20H19NO3S — CID 6959903
ethyl (3R,4R,5R)-5-benzoyl-2-imino-4-phenylthiolane-3-carboxylate (PubChem CID 6959903) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is ethyl (3R,4R,5R)-5-benzoyl-2-imino-4-phenylthiolane-3-carboxylate.
| Compound Name | ethyl (3R,4R,5R)-5-benzoyl-2-imino-4-phenylthiolane-3-carboxylate |
|---|---|
| PubChem CID | 6959903 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | ethyl (3R,4R,5R)-5-benzoyl-2-imino-4-phenylthiolane-3-carboxylate |
| SMILES | [H]/N=C1\S[C@@H](C(=O)c2ccccc2)[C@@H](c2ccccc2)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C20H19NO3S/c1-2-24-20(23)16-15(13-9-5-3-6-10-13)18(25-19(16)21)17(22)14-11-7-4-8-12-14/h3-12,15-16,18,21H,2H2,1H3/b21-19-/t15-,16-,18+/m0/s1 |
| InChIKey | LTWJIERUVNTCHN-SYFGSMQSSA-N |
| XLogP | 3.93 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|