C20H20O2S — CID 13122708
ethyl 3,6-diphenyl-3,6-dihydro-2H-thiopyran-2-carboxylate (PubChem CID 13122708) has the molecular formula C20H20O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is ethyl 3,6-diphenyl-3,6-dihydro-2H-thiopyran-2-carboxylate.
| Compound Name | ethyl 3,6-diphenyl-3,6-dihydro-2H-thiopyran-2-carboxylate |
|---|---|
| PubChem CID | 13122708 |
| Molecular Formula | C20H20O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | ethyl 3,6-diphenyl-3,6-dihydro-2H-thiopyran-2-carboxylate |
| SMILES | CCOC(=O)C1SC(c2ccccc2)C=CC1c1ccccc1 |
| InChI | InChI=1S/C20H20O2S/c1-2-22-20(21)19-17(15-9-5-3-6-10-15)13-14-18(23-19)16-11-7-4-8-12-16/h3-14,17-19H,2H2,1H3 |
| InChIKey | CMXRBYGSOXFOJW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|