C32H21BrF6 — CID 174833805
2-[2-bromo-4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydrochrysene (PubChem CID 174833805) has the molecular formula C32H21BrF6 and a molecular weight of 599.41 g/mol. Its IUPAC name is 2-[2-bromo-4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydrochrysene.
| Compound Name | 2-[2-bromo-4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174833805 |
| Molecular Formula | C32H21BrF6 |
| Molecular Weight | 599.41 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 2-[2-bromo-4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydrochrysene |
| SMILES | FC(F)(F)c1cccc(C2CC(c3ccc(C(F)(F)F)cc3Br)Cc3ccc4c(ccc5ccccc54)c32)c1 |
| InChI | InChI=1S/C32H21BrF6/c33-29-17-23(32(37,38)39)10-13-25(29)21-14-20-9-11-26-24-7-2-1-4-18(24)8-12-27(26)30(20)28(16-21)19-5-3-6-22(15-19)31(34,35)36/h1-13,15,17,21,28H,14,16H2 |
| InChIKey | ZWTGIIMVXYTAGS-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.41 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|