C27H23F3O2S — CID 175305946
1-ethyl-4-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4-tetrahydrochrysene (PubChem CID 175305946) has the molecular formula C27H23F3O2S and a molecular weight of 468.54 g/mol. Its IUPAC name is 1-ethyl-4-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4-tetrahydrochrysene.
| Compound Name | 1-ethyl-4-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 175305946 |
| Molecular Formula | C27H23F3O2S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1-ethyl-4-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4-tetrahydrochrysene |
| SMILES | CCC1CCC(S(=O)(=O)c2cccc(C(F)(F)F)c2)c2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C27H23F3O2S/c1-2-17-11-15-25(33(31,32)20-8-5-7-19(16-20)27(28,29)30)26-22(17)13-14-23-21-9-4-3-6-18(21)10-12-24(23)26/h3-10,12-14,16-17,25H,2,11,15H2,1H3 |
| InChIKey | UCGDZKCXGOHSQI-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|