C17H16N2O5 — CID 170913271
methyl 3-cyano-2-imino-6-(2-methoxy-2-oxoethyl)-4-phenyl-3,4-dihydropyran-5-carboxylate (PubChem CID 170913271) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is methyl 3-cyano-2-imino-6-(2-methoxy-2-oxoethyl)-4-phenyl-3,4-dihydropyran-5-carboxylate.
| Compound Name | methyl 3-cyano-2-imino-6-(2-methoxy-2-oxoethyl)-4-phenyl-3,4-dihydropyran-5-carboxylate |
|---|---|
| PubChem CID | 170913271 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 3-cyano-2-imino-6-(2-methoxy-2-oxoethyl)-4-phenyl-3,4-dihydropyran-5-carboxylate |
| SMILES | [H]/N=C1\OC(CC(=O)OC)=C(C(=O)OC)C(c2ccccc2)C1C#N |
| InChI | InChI=1S/C17H16N2O5/c1-22-13(20)8-12-15(17(21)23-2)14(10-6-4-3-5-7-10)11(9-18)16(19)24-12/h3-7,11,14,19H,8H2,1-2H3/b19-16- |
| InChIKey | DHRJUODWHFRGKM-MNDPQUGUSA-N |
| XLogP | 1.91 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|