C22H20N2O3 — CID 91933426
2-imino-5-oxo-4,7-diphenyl-4,6,7,8-tetrahydro-3H-chromene-3-carboxamide (PubChem CID 91933426) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-imino-5-oxo-4,7-diphenyl-4,6,7,8-tetrahydro-3H-chromene-3-carboxamide.
| Compound Name | 2-imino-5-oxo-4,7-diphenyl-4,6,7,8-tetrahydro-3H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 91933426 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-imino-5-oxo-4,7-diphenyl-4,6,7,8-tetrahydro-3H-chromene-3-carboxamide |
| SMILES | [H]/N=C1\OC2=C(C(=O)CC(c3ccccc3)C2)C(c2ccccc2)C1C(N)=O |
| InChI | InChI=1S/C22H20N2O3/c23-21(26)20-18(14-9-5-2-6-10-14)19-16(25)11-15(12-17(19)27-22(20)24)13-7-3-1-4-8-13/h1-10,15,18,20,24H,11-12H2,(H2,23,26)/b24-22- |
| InChIKey | ACJRUOKNROMQLP-GYHWCHFESA-N |
| XLogP | 3.28 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|