C33H31NO3 — CID 46243563
9-[4-(dimethylamino)phenyl]-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 46243563) has the molecular formula C33H31NO3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 9-[4-(dimethylamino)phenyl]-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[4-(dimethylamino)phenyl]-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 46243563 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 9-[4-(dimethylamino)phenyl]-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | CN(C)c1ccc(C2C3=C(CC(c4ccccc4)CC3=O)OC3=C2C(=O)CC(c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C33H31NO3/c1-34(2)26-15-13-23(14-16-26)31-32-27(35)17-24(21-9-5-3-6-10-21)19-29(32)37-30-20-25(18-28(36)33(30)31)22-11-7-4-8-12-22/h3-16,24-25,31H,17-20H2,1-2H3 |
| InChIKey | SSADXNFNZVRQAP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |