C37H37NO5 — CID 1397882
(3S,6S)-9-[4-(2-morpholin-4-ylethoxy)phenyl]-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 1397882) has the molecular formula C37H37NO5 and a molecular weight of 575.70 g/mol. Its IUPAC name is (3S,6S)-9-[4-(2-morpholin-4-ylethoxy)phenyl]-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | (3S,6S)-9-[4-(2-morpholin-4-ylethoxy)phenyl]-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1397882 |
| Molecular Formula | C37H37NO5 |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | (3S,6S)-9-[4-(2-morpholin-4-ylethoxy)phenyl]-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | O=C1C[C@@H](c2ccccc2)CC2=C1C(c1ccc(OCCN3CCOCC3)cc1)C1=C(C[C@H](c3ccccc3)CC1=O)O2 |
| InChI | InChI=1S/C37H37NO5/c39-31-21-28(25-7-3-1-4-8-25)23-33-36(31)35(27-11-13-30(14-12-27)42-20-17-38-15-18-41-19-16-38)37-32(40)22-29(24-34(37)43-33)26-9-5-2-6-10-26/h1-14,28-29,35H,15-24H2/t28-,29-/m1/s1 |
| InChIKey | QZZCZVJCDCJUIJ-FQLXRVMXSA-N |
| XLogP | 6.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |