C25H17Cl3O3 — CID 139260737
(3'R,5'S)-5-chloro-3',5'-bis(3-chlorophenyl)spiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione (PubChem CID 139260737) has the molecular formula C25H17Cl3O3 and a molecular weight of 471.77 g/mol. Its IUPAC name is (3'R,5'S)-5-chloro-3',5'-bis(3-chlorophenyl)spiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione.
| Compound Name | (3'R,5'S)-5-chloro-3',5'-bis(3-chlorophenyl)spiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione |
|---|---|
| PubChem CID | 139260737 |
| Molecular Formula | C25H17Cl3O3 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | (3'R,5'S)-5-chloro-3',5'-bis(3-chlorophenyl)spiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione |
| SMILES | O=C1C[C@H](c2cccc(Cl)c2)C2(C(=O)Oc3ccc(Cl)cc32)[C@H](c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C25H17Cl3O3/c26-16-5-1-3-14(9-16)20-12-19(29)13-21(15-4-2-6-17(27)10-15)25(20)22-11-18(28)7-8-23(22)31-24(25)30/h1-11,20-21H,12-13H2/t20-,21+,25? |
| InChIKey | VDKLBSOFLSWZTD-KEVCNVLYSA-N |
| XLogP | 6.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|