C20H17BrClNO3 — CID 141220685
1'-bromo-3-(3-chlorophenyl)-5-methoxyspiro[cyclohexane-4,3'-indole]-1,2'-dione (PubChem CID 141220685) has the molecular formula C20H17BrClNO3 and a molecular weight of 434.72 g/mol. Its IUPAC name is 1'-bromo-3-(3-chlorophenyl)-5-methoxyspiro[cyclohexane-4,3'-indole]-1,2'-dione.
| Compound Name | 1'-bromo-3-(3-chlorophenyl)-5-methoxyspiro[cyclohexane-4,3'-indole]-1,2'-dione |
|---|---|
| PubChem CID | 141220685 |
| Molecular Formula | C20H17BrClNO3 |
| Molecular Weight | 434.72 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 1'-bromo-3-(3-chlorophenyl)-5-methoxyspiro[cyclohexane-4,3'-indole]-1,2'-dione |
| SMILES | COC1CC(=O)CC(c2cccc(Cl)c2)C12C(=O)N(Br)c1ccccc12 |
| InChI | InChI=1S/C20H17BrClNO3/c1-26-18-11-14(24)10-16(12-5-4-6-13(22)9-12)20(18)15-7-2-3-8-17(15)23(21)19(20)25/h2-9,16,18H,10-11H2,1H3 |
| InChIKey | LPRFATUYZMBUPX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|