About 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one
1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one (PubChem CID 141220686) has the molecular formula C20H18BrClN2O3
and a molecular weight of 449.73 g/mol. Its IUPAC name is 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one |
| PubChem CID | 141220686 |
| Molecular Formula | C20H18BrClN2O3 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one |
| SMILES | COC1CC(=NO)CC(c2cccc(Cl)c2)C12C(=O)N(Br)c1ccccc12 |
| InChI | InChI=1S/C20H18BrClN2O3/c1-27-18-11-14(23-26)10-16(12-5-4-6-13(22)9-12)20(18)15-7-2-3-8-17(15)24(21)19(20)25/h2-9,16,18,26H,10-11H2,1H3 |
| InChIKey | IOVCEULEDWTRHT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one?
The IUPAC name of 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one (CID 141220686) is 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one.
What is the SMILES notation for 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one?
The canonical SMILES for 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one is COC1CC(=NO)CC(c2cccc(Cl)c2)C12C(=O)N(Br)c1ccccc12.
What is the InChIKey of 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one?
The InChIKey is IOVCEULEDWTRHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BrClN2O3/c1-27-18-11-14(23-26)10-16(12-5-4-6-13(22)9-12)20(18)15-7-2-3-8-17(15)24(21)19(20)25/h2-9,16,18,26H,10-11H2,1H3.
What are the key properties of 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one?
1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one has a molecular weight of 449.73 g/mol, XLogP of 4.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-bromo-2-(3-chlorophenyl)-4-hydroxyimino-6-methoxyspiro[cyclohexane-1,3'-indole]-2'-one is sourced from PubChem (CID 141220686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).