C22H20BrClN2O2 — CID 86624805
(2'S,3S,4'E,6'S)-6-bromo-2'-(3-chlorophenyl)-4'-hydroxyimino-6'-prop-1-en-2-ylspiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 86624805) has the molecular formula C22H20BrClN2O2 and a molecular weight of 459.77 g/mol. Its IUPAC name is (2'S,3S,4'E,6'S)-6-bromo-2'-(3-chlorophenyl)-4'-hydroxyimino-6'-prop-1-en-2-ylspiro[1H-indole-3,1'-cyclohexane]-2-one.
| Compound Name | (2'S,3S,4'E,6'S)-6-bromo-2'-(3-chlorophenyl)-4'-hydroxyimino-6'-prop-1-en-2-ylspiro[1H-indole-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 86624805 |
| Molecular Formula | C22H20BrClN2O2 |
| Molecular Weight | 459.77 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (2'S,3S,4'E,6'S)-6-bromo-2'-(3-chlorophenyl)-4'-hydroxyimino-6'-prop-1-en-2-ylspiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | C=C(C)[C@@H]1C/C(=N\O)C[C@@H](c2cccc(Cl)c2)[C@@]12C(=O)Nc1cc(Br)ccc12 |
| InChI | InChI=1S/C22H20BrClN2O2/c1-12(2)18-10-16(26-28)11-19(13-4-3-5-15(24)8-13)22(18)17-7-6-14(23)9-20(17)25-21(22)27/h3-9,18-19,28H,1,10-11H2,2H3,(H,25,27)/b26-16+/t18-,19-,22-/m0/s1 |
| InChIKey | QQIQUPCQDHAWTI-CGQFJMMUSA-N |
| XLogP | 5.89 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.77 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|