C24H24Cl2N2O2 — CID 69156437
6-chloro-4'-(3-chlorophenyl)-6'-(4-methylpent-1-en-2-yl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 69156437) has the molecular formula C24H24Cl2N2O2 and a molecular weight of 443.37 g/mol. Its IUPAC name is 6-chloro-4'-(3-chlorophenyl)-6'-(4-methylpent-1-en-2-yl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | 6-chloro-4'-(3-chlorophenyl)-6'-(4-methylpent-1-en-2-yl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 69156437 |
| Molecular Formula | C24H24Cl2N2O2 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 6-chloro-4'-(3-chlorophenyl)-6'-(4-methylpent-1-en-2-yl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C=C(CC(C)C)C1NC(=O)CC(c2cccc(Cl)c2)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C24H24Cl2N2O2/c1-13(2)9-14(3)22-24(18-8-7-17(26)11-20(18)27-23(24)30)19(12-21(29)28-22)15-5-4-6-16(25)10-15/h4-8,10-11,13,19,22H,3,9,12H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | SCXLDLANGBYONG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|