C22H22BrClN2O2 — CID 88870533
(3R,4S,5S)-4-(2-amino-4-bromophenyl)-5-(3-chlorophenyl)-7-oxo-3-prop-1-en-2-ylazepane-4-carbaldehyde (PubChem CID 88870533) has the molecular formula C22H22BrClN2O2 and a molecular weight of 461.79 g/mol. Its IUPAC name is (3R,4S,5S)-4-(2-amino-4-bromophenyl)-5-(3-chlorophenyl)-7-oxo-3-prop-1-en-2-ylazepane-4-carbaldehyde.
| Compound Name | (3R,4S,5S)-4-(2-amino-4-bromophenyl)-5-(3-chlorophenyl)-7-oxo-3-prop-1-en-2-ylazepane-4-carbaldehyde |
|---|---|
| PubChem CID | 88870533 |
| Molecular Formula | C22H22BrClN2O2 |
| Molecular Weight | 461.79 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | (3R,4S,5S)-4-(2-amino-4-bromophenyl)-5-(3-chlorophenyl)-7-oxo-3-prop-1-en-2-ylazepane-4-carbaldehyde |
| SMILES | C=C(C)[C@H]1CNC(=O)C[C@@H](c2cccc(Cl)c2)[C@@]1(C=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C22H22BrClN2O2/c1-13(2)19-11-26-21(28)10-18(14-4-3-5-16(24)8-14)22(19,12-27)17-7-6-15(23)9-20(17)25/h3-9,12,18-19H,1,10-11,25H2,2H3,(H,26,28)/t18-,19+,22+/m0/s1 |
| InChIKey | SJOXJSYZVDGLJX-NNMXDRDESA-N |
| XLogP | 4.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.79 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|