C22H18BrClN2O4 — CID 142696776
6-bromo-4'-(3-chlorophenyl)-2,6'-dioxo-2'-prop-1-en-2-ylspiro[indole-3,3'-piperidine]-1-carboxylic acid (PubChem CID 142696776) has the molecular formula C22H18BrClN2O4 and a molecular weight of 489.75 g/mol. Its IUPAC name is 6-bromo-4'-(3-chlorophenyl)-2,6'-dioxo-2'-prop-1-en-2-ylspiro[indole-3,3'-piperidine]-1-carboxylic acid.
| Compound Name | 6-bromo-4'-(3-chlorophenyl)-2,6'-dioxo-2'-prop-1-en-2-ylspiro[indole-3,3'-piperidine]-1-carboxylic acid |
|---|---|
| PubChem CID | 142696776 |
| Molecular Formula | C22H18BrClN2O4 |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | 6-bromo-4'-(3-chlorophenyl)-2,6'-dioxo-2'-prop-1-en-2-ylspiro[indole-3,3'-piperidine]-1-carboxylic acid |
| SMILES | C=C(C)C1NC(=O)CC(c2cccc(Cl)c2)C12C(=O)N(C(=O)O)c1cc(Br)ccc12 |
| InChI | InChI=1S/C22H18BrClN2O4/c1-11(2)19-22(16(10-18(27)25-19)12-4-3-5-14(24)8-12)15-7-6-13(23)9-17(15)26(20(22)28)21(29)30/h3-9,16,19H,1,10H2,2H3,(H,25,27)(H,29,30) |
| InChIKey | JCCKGCZWMUDMRF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|