C19H15NOS2 — CID 139040231
(3R)-3-phenylsulfanyl-3-(thiophen-2-ylmethyl)-1H-indol-2-one (PubChem CID 139040231) has the molecular formula C19H15NOS2 and a molecular weight of 337.47 g/mol. Its IUPAC name is (3R)-3-phenylsulfanyl-3-(thiophen-2-ylmethyl)-1H-indol-2-one.
| Compound Name | (3R)-3-phenylsulfanyl-3-(thiophen-2-ylmethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 139040231 |
| Molecular Formula | C19H15NOS2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | (3R)-3-phenylsulfanyl-3-(thiophen-2-ylmethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2[C@@]1(Cc1cccs1)Sc1ccccc1 |
| InChI | InChI=1S/C19H15NOS2/c21-18-19(13-15-9-6-12-22-15,23-14-7-2-1-3-8-14)16-10-4-5-11-17(16)20-18/h1-12H,13H2,(H,20,21)/t19-/m1/s1 |
| InChIKey | FCZYKXSGZHCYPZ-LJQANCHMSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |