C16H16ClN3O3S — CID 171151517
5-(2-pyridin-1-ium-4-ylethyl)-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione chloride (PubChem CID 171151517) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is 5-(2-pyridin-1-ium-4-ylethyl)-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione chloride.
| Compound Name | 5-(2-pyridin-1-ium-4-ylethyl)-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione chloride |
|---|---|
| PubChem CID | 171151517 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 5-(2-pyridin-1-ium-4-ylethyl)-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione chloride |
| SMILES | O=C1NC(=O)C(CCc2cc[nH+]cc2)(Cc2cccs2)C(=O)N1.[Cl-] |
| InChI | InChI=1S/C16H15N3O3S.ClH/c20-13-16(10-12-2-1-9-23-12,14(21)19-15(22)18-13)6-3-11-4-7-17-8-5-11;/h1-2,4-5,7-9H,3,6,10H2,(H2,18,19,20,21,22);1H |
| InChIKey | FOFFKEOFGNFWIK-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|