C12H11N3OS2 — CID 95656033
(4R)-2-amino-4-thiophen-2-yl-4-(thiophen-2-ylmethyl)-1H-imidazol-5-one (PubChem CID 95656033) has the molecular formula C12H11N3OS2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (4R)-2-amino-4-thiophen-2-yl-4-(thiophen-2-ylmethyl)-1H-imidazol-5-one.
| Compound Name | (4R)-2-amino-4-thiophen-2-yl-4-(thiophen-2-ylmethyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 95656033 |
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (4R)-2-amino-4-thiophen-2-yl-4-(thiophen-2-ylmethyl)-1H-imidazol-5-one |
| SMILES | NC1=N[C@@](Cc2cccs2)(c2cccs2)C(=O)N1 |
| InChI | InChI=1S/C12H11N3OS2/c13-11-14-10(16)12(15-11,9-4-2-6-18-9)7-8-3-1-5-17-8/h1-6H,7H2,(H3,13,14,15,16)/t12-/m0/s1 |
| InChIKey | WDYZOIJONYUEJP-LBPRGKRZSA-N |
| XLogP | 1.69 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |