C9H10N2OS — CID 106953389
4,4-dimethyl-2-thiophen-2-yl-1H-imidazol-5-one (PubChem CID 106953389) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 4,4-dimethyl-2-thiophen-2-yl-1H-imidazol-5-one.
| Compound Name | 4,4-dimethyl-2-thiophen-2-yl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 106953389 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 4,4-dimethyl-2-thiophen-2-yl-1H-imidazol-5-one |
| SMILES | CC1(C)N=C(c2cccs2)NC1=O |
| InChI | InChI=1S/C9H10N2OS/c1-9(2)8(12)10-7(11-9)6-4-3-5-13-6/h3-5H,1-2H3,(H,10,11,12) |
| InChIKey | ACSTVFJHPJRSFU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |