C12H17N5S — CID 152634864
4-cyclopentyl-6-thiophen-2-yl-1H-1,3,5-triazine-2,4-diamine (PubChem CID 152634864) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is 4-cyclopentyl-6-thiophen-2-yl-1H-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-cyclopentyl-6-thiophen-2-yl-1H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 152634864 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-cyclopentyl-6-thiophen-2-yl-1H-1,3,5-triazine-2,4-diamine |
| SMILES | NC1=NC(N)(C2CCCC2)N=C(c2cccs2)N1 |
| InChI | InChI=1S/C12H17N5S/c13-11-15-10(9-6-3-7-18-9)16-12(14,17-11)8-4-1-2-5-8/h3,6-8H,1-2,4-5,14H2,(H3,13,15,16,17) |
| InChIKey | ZEHYPJNRXFLBTK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |