C13H16N2OS — CID 167789167
(3aR,6aS)-3'-thiophen-2-ylspiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,5'-2H-1,2,4-oxadiazole] (PubChem CID 167789167) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is (3aR,6aS)-3'-thiophen-2-ylspiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,5'-2H-1,2,4-oxadiazole].
| Compound Name | (3aR,6aS)-3'-thiophen-2-ylspiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,5'-2H-1,2,4-oxadiazole] |
|---|---|
| PubChem CID | 167789167 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (3aR,6aS)-3'-thiophen-2-ylspiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,5'-2H-1,2,4-oxadiazole] |
| SMILES | c1csc(C2=NC3(C[C@H]4CCC[C@H]4C3)ON2)c1 |
| InChI | InChI=1S/C13H16N2OS/c1-3-9-7-13(8-10(9)4-1)14-12(15-16-13)11-5-2-6-17-11/h2,5-6,9-10H,1,3-4,7-8H2,(H,14,15)/t9-,10+,13? |
| InChIKey | JAELXZZVNJDCHT-HWYHXSKPSA-N |
| XLogP | 2.94 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |