C17H16S — CID 134943035
2-[(1S,5R)-7-phenyl-6-bicyclo[3.2.0]hept-6-enyl]thiophene (PubChem CID 134943035) has the molecular formula C17H16S and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-[(1S,5R)-7-phenyl-6-bicyclo[3.2.0]hept-6-enyl]thiophene.
| Compound Name | 2-[(1S,5R)-7-phenyl-6-bicyclo[3.2.0]hept-6-enyl]thiophene |
|---|---|
| PubChem CID | 134943035 |
| Molecular Formula | C17H16S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-[(1S,5R)-7-phenyl-6-bicyclo[3.2.0]hept-6-enyl]thiophene |
| SMILES | c1ccc(C2=C(c3cccs3)[C@@H]3CCC[C@H]23)cc1 |
| InChI | InChI=1S/C17H16S/c1-2-6-12(7-3-1)16-13-8-4-9-14(13)17(16)15-10-5-11-18-15/h1-3,5-7,10-11,13-14H,4,8-9H2/t13-,14+/m0/s1 |
| InChIKey | GTOBLINKAVAWJR-UONOGXRCSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |