C17H22N2OS — CID 98764476
3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-thiophen-2-yl-1,2-oxazole (PubChem CID 98764476) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-thiophen-2-yl-1,2-oxazole.
| Compound Name | 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-thiophen-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 98764476 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-thiophen-2-yl-1,2-oxazole |
| SMILES | c1csc(-c2cc(CN3CCC[C@H]4CCCC[C@H]43)no2)c1 |
| InChI | InChI=1S/C17H22N2OS/c1-2-7-15-13(5-1)6-3-9-19(15)12-14-11-16(20-18-14)17-8-4-10-21-17/h4,8,10-11,13,15H,1-3,5-7,9,12H2/t13-,15-/m1/s1 |
| InChIKey | ZCRCKCFAYICQFN-UKRRQHHQSA-N |
| XLogP | 4.56 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |