C11H12N2O2S — CID 63092006
1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]azetidin-3-ol (PubChem CID 63092006) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]azetidin-3-ol.
| Compound Name | 1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]azetidin-3-ol |
|---|---|
| PubChem CID | 63092006 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]azetidin-3-ol |
| SMILES | OC1CN(Cc2cc(-c3cccs3)on2)C1 |
| InChI | InChI=1S/C11H12N2O2S/c14-9-6-13(7-9)5-8-4-10(15-12-8)11-2-1-3-16-11/h1-4,9,14H,5-7H2 |
| InChIKey | FTFNRNWIACIFNY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |