C10H11NO2S — CID 170887655
3-(5-thiophen-2-yl-1,2-oxazol-3-yl)propan-1-ol (PubChem CID 170887655) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-(5-thiophen-2-yl-1,2-oxazol-3-yl)propan-1-ol.
| Compound Name | 3-(5-thiophen-2-yl-1,2-oxazol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 170887655 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-(5-thiophen-2-yl-1,2-oxazol-3-yl)propan-1-ol |
| SMILES | OCCCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C10H11NO2S/c12-5-1-3-8-7-9(13-11-8)10-4-2-6-14-10/h2,4,6-7,12H,1,3,5H2 |
| InChIKey | DRFDTQCDXOQALD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |