C14H11NO2S2 — CID 104590345
3-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]phenol (PubChem CID 104590345) has the molecular formula C14H11NO2S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]phenol.
| Compound Name | 3-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 104590345 |
| Molecular Formula | C14H11NO2S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]phenol |
| SMILES | Oc1cccc(SCc2cc(-c3cccs3)on2)c1 |
| InChI | InChI=1S/C14H11NO2S2/c16-11-3-1-4-12(8-11)19-9-10-7-13(17-15-10)14-5-2-6-18-14/h1-8,16H,9H2 |
| InChIKey | GIJXSAUTQFSMFV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |