C14H11ClN2OS2 — CID 79528047
4-chloro-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]aniline (PubChem CID 79528047) has the molecular formula C14H11ClN2OS2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 4-chloro-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 4-chloro-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79528047 |
| Molecular Formula | C14H11ClN2OS2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 4-chloro-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]aniline |
| SMILES | Nc1ccc(Cl)cc1SCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C14H11ClN2OS2/c15-9-3-4-11(16)14(6-9)20-8-10-7-12(18-17-10)13-2-1-5-19-13/h1-7H,8,16H2 |
| InChIKey | WHTZMLGPNIUAQX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|