C12H10ClN3S2 — CID 115332050
4-chloro-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)aniline (PubChem CID 115332050) has the molecular formula C12H10ClN3S2 and a molecular weight of 295.82 g/mol. Its IUPAC name is 4-chloro-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)aniline.
| Compound Name | 4-chloro-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 115332050 |
| Molecular Formula | C12H10ClN3S2 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 4-chloro-2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(Cl)cc1SCc1cn2ccsc2n1 |
| InChI | InChI=1S/C12H10ClN3S2/c13-8-1-2-10(14)11(5-8)18-7-9-6-16-3-4-17-12(16)15-9/h1-6H,7,14H2 |
| InChIKey | BBSFAJQPAUUFDN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|