C12H9ClIN3S — CID 107634891
4-chloro-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-iodoaniline (PubChem CID 107634891) has the molecular formula C12H9ClIN3S and a molecular weight of 389.65 g/mol. Its IUPAC name is 4-chloro-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-iodoaniline.
| Compound Name | 4-chloro-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-iodoaniline |
|---|---|
| PubChem CID | 107634891 |
| Molecular Formula | C12H9ClIN3S |
| Molecular Weight | 389.65 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | 4-chloro-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-iodoaniline |
| SMILES | Clc1ccc(NCc2cn3ccsc3n2)c(I)c1 |
| InChI | InChI=1S/C12H9ClIN3S/c13-8-1-2-11(10(14)5-8)15-6-9-7-17-3-4-18-12(17)16-9/h1-5,7,15H,6H2 |
| InChIKey | BLYLFVNBBIFCEC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|