C12H9ClN2OS — CID 115334810
6-[(3-chlorophenoxy)methyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 115334810) has the molecular formula C12H9ClN2OS and a molecular weight of 264.74 g/mol. Its IUPAC name is 6-[(3-chlorophenoxy)methyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[(3-chlorophenoxy)methyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 115334810 |
| Molecular Formula | C12H9ClN2OS |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 6-[(3-chlorophenoxy)methyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | Clc1cccc(OCc2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C12H9ClN2OS/c13-9-2-1-3-11(6-9)16-8-10-7-15-4-5-17-12(15)14-10/h1-7H,8H2 |
| InChIKey | ZPHGIYBVIQXIBC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |