C13H10ClN3OS2 — CID 115331871
2-chloro-6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzenecarbothioamide (PubChem CID 115331871) has the molecular formula C13H10ClN3OS2 and a molecular weight of 323.83 g/mol. Its IUPAC name is 2-chloro-6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzenecarbothioamide.
| Compound Name | 2-chloro-6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 115331871 |
| Molecular Formula | C13H10ClN3OS2 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2-chloro-6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1c(Cl)cccc1OCc1cn2ccsc2n1 |
| InChI | InChI=1S/C13H10ClN3OS2/c14-9-2-1-3-10(11(9)12(15)19)18-7-8-6-17-4-5-20-13(17)16-8/h1-6H,7H2,(H2,15,19) |
| InChIKey | MKXRRJCHXGBFQG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|