C13H12N2O2S — CID 113288919
[2-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)phenyl]methanol (PubChem CID 113288919) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is [2-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)phenyl]methanol.
| Compound Name | [2-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 113288919 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | [2-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)phenyl]methanol |
| SMILES | OCc1ccccc1OCc1cn2ccsc2n1 |
| InChI | InChI=1S/C13H12N2O2S/c16-8-10-3-1-2-4-12(10)17-9-11-7-15-5-6-18-13(15)14-11/h1-7,16H,8-9H2 |
| InChIKey | SFIRXAMMRNQAKG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |