C13H11N3O4S — CID 115332158
[2-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-5-nitrophenyl]methanol (PubChem CID 115332158) has the molecular formula C13H11N3O4S and a molecular weight of 305.32 g/mol. Its IUPAC name is [2-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-5-nitrophenyl]methanol.
| Compound Name | [2-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-5-nitrophenyl]methanol |
|---|---|
| PubChem CID | 115332158 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [2-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-5-nitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(OCc2cn3ccsc3n2)c(CO)c1 |
| InChI | InChI=1S/C13H11N3O4S/c17-7-9-5-11(16(18)19)1-2-12(9)20-8-10-6-15-3-4-21-13(15)14-10/h1-6,17H,7-8H2 |
| InChIKey | YMOSIKQIPZYFQU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|