C16H13ClN4O5S — CID 23853914
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate (PubChem CID 23853914) has the molecular formula C16H13ClN4O5S and a molecular weight of 408.82 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate |
|---|---|
| PubChem CID | 23853914 |
| Molecular Formula | C16H13ClN4O5S |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-imidazo[2,1-b][1,3]thiazol-6-ylacetate |
| SMILES | CC(OC(=O)Cc1cn2ccsc2n1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H13ClN4O5S/c1-9(15(23)19-13-3-2-11(21(24)25)7-12(13)17)26-14(22)6-10-8-20-4-5-27-16(20)18-10/h2-5,7-9H,6H2,1H3,(H,19,23) |
| InChIKey | RQXLKWRFQXWZPT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|