C21H25ClN2O5 — CID 4680282
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(1-adamantyl)acetate (PubChem CID 4680282) has the molecular formula C21H25ClN2O5 and a molecular weight of 420.89 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(1-adamantyl)acetate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 4680282 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(1-adamantyl)acetate |
| SMILES | CC(OC(=O)CC12CC3CC(CC(C3)C1)C2)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H25ClN2O5/c1-12(20(26)23-18-3-2-16(24(27)28)7-17(18)22)29-19(25)11-21-8-13-4-14(9-21)6-15(5-13)10-21/h2-3,7,12-15H,4-6,8-11H2,1H3,(H,23,26) |
| InChIKey | WVBNHDOFPFHLEY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|