C17H16ClN3O6S — CID 41056813
[(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate (PubChem CID 41056813) has the molecular formula C17H16ClN3O6S and a molecular weight of 425.85 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate.
| Compound Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 41056813 |
| Molecular Formula | C17H16ClN3O6S |
| Molecular Weight | 425.85 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)O[C@@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)s1 |
| InChI | InChI=1S/C17H16ClN3O6S/c1-9-3-6-14(28-9)17(24)19-8-15(22)27-10(2)16(23)20-13-5-4-11(21(25)26)7-12(13)18/h3-7,10H,8H2,1-2H3,(H,19,24)(H,20,23)/t10-/m0/s1 |
| InChIKey | GLYQFCSACXADQI-JTQLQIEISA-N |
| XLogP | 2.92 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|