C19H15ClN4O5S — CID 43029588
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 43029588) has the molecular formula C19H15ClN4O5S and a molecular weight of 446.87 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 43029588 |
| Molecular Formula | C19H15ClN4O5S |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | CC(OC(=O)Cc1csc(-c2ccccn2)n1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H15ClN4O5S/c1-11(18(26)23-15-6-5-13(24(27)28)9-14(15)20)29-17(25)8-12-10-30-19(22-12)16-4-2-3-7-21-16/h2-7,9-11H,8H2,1H3,(H,23,26) |
| InChIKey | JKHXYQQGBJRZRV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|