C13H11ClN4O2S — CID 115331982
2-chloro-N'-hydroxy-6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzenecarboximidamide (PubChem CID 115331982) has the molecular formula C13H11ClN4O2S and a molecular weight of 322.78 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 115331982 |
| Molecular Formula | C13H11ClN4O2S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-chloro-N'-hydroxy-6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1c(Cl)cccc1OCc1cn2ccsc2n1 |
| InChI | InChI=1S/C13H11ClN4O2S/c14-9-2-1-3-10(11(9)12(15)17-19)20-7-8-6-18-4-5-21-13(18)16-8/h1-6,19H,7H2,(H2,15,17) |
| InChIKey | VMEXBLWBRYFUME-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|