C13H10ClN3O2S — CID 79726580
imidazo[2,1-b][1,3]thiazol-6-ylmethyl 2-amino-3-chlorobenzoate (PubChem CID 79726580) has the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. Its IUPAC name is imidazo[2,1-b][1,3]thiazol-6-ylmethyl 2-amino-3-chlorobenzoate.
| Compound Name | imidazo[2,1-b][1,3]thiazol-6-ylmethyl 2-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 79726580 |
| Molecular Formula | C13H10ClN3O2S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | imidazo[2,1-b][1,3]thiazol-6-ylmethyl 2-amino-3-chlorobenzoate |
| SMILES | Nc1c(Cl)cccc1C(=O)OCc1cn2ccsc2n1 |
| InChI | InChI=1S/C13H10ClN3O2S/c14-10-3-1-2-9(11(10)15)12(18)19-7-8-6-17-4-5-20-13(17)16-8/h1-6H,7,15H2 |
| InChIKey | BPHHMOXMECNUCE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|